Chemical Bonding-Focus Ionic! Bonding: Ionic, Metallic, & Covalent.
Chapter 7 Ionic and Metallic Bonding
description
Transcript of Chapter 7 Ionic and Metallic Bonding
Chapter 7Chapter 7Ionic and Metallic BondingIonic and Metallic Bonding
Ms. WangMs. WangLawndale High SchoolLawndale High School
Section 7.1 - IonsSection 7.1 - Ions
• Valence Electrons – electrons in the highest occupied energy level of an element’s atoms
• To find the valence electrons in an atom of the representative element, simply look at the group number
Electron Configuration and Electron Configuration and Valence ElectronsValence Electrons
Example: How many electrons are in the Example: How many electrons are in the valence shell of sodium?valence shell of sodium?
Step 1: Write the electron configuration of Step 1: Write the electron configuration of sodiumsodium
Na = [Ne]3sNa = [Ne]3s11
Step 2: Count the number of electrons in the Step 2: Count the number of electrons in the valence shell (outermost shell). valence shell (outermost shell).
Determine the Valence electrons Determine the Valence electrons in each of these elementsin each of these elements
1.1. KK 6. Be6. Be2.2. PP 7. Li7. Li3.3. CC 8. He8. He4.4. OO 9. Ne9. Ne5.5. NN 10. B10. B
Electron Dot Structure Electron Dot Structure Diagrams that show valence Diagrams that show valence
electrons as dots electrons as dots
X3 5
1
8
2
6
4 7
PRACTICEPRACTICE
1. K1. K 6. Be6. Be
2. P2. P 7. Li7. Li
3. C3. C 8. He8. He
4. O4. O 9. Ne9. Ne
5. N5. N 10. B10. B
Octet RuleOctet Rule Eight electrons in the highest Eight electrons in the highest
occupied energy level just like the occupied energy level just like the noble gases (except He)noble gases (except He)
Metal elements lose their valence Metal elements lose their valence electronselectrons
Nonmetal elements gain electronsNonmetal elements gain electrons
Formation of CationsFormation of Cations
3s
2p
2s
1s
Sodium atom
Na
Sodium ion
Na+
Neon atom
Ne
Na Na+ + e-
Formation of AnionsFormation of Anions2p
2s
1s
Fluorine atom
F
Fluorine ion
F-
Neon atom
Ne
F + e- F-
PracticePractice
1.1. Show how a Lithium atom becomes an cationShow how a Lithium atom becomes an cation
2. Show how a Calcium atom becomes a cation2. Show how a Calcium atom becomes a cation
3. Show how a Chlorine atom becomes an anion3. Show how a Chlorine atom becomes an anion
4. Show how an Oxygen atom becomes an anion4. Show how an Oxygen atom becomes an anion
BondingBondingOnce an atom has a stable octet, it is Once an atom has a stable octet, it is
happy and doesn’t want to react anymorehappy and doesn’t want to react anymore
Atoms without stable octets, Atoms without stable octets, are sad and want to react with are sad and want to react with another element to achieve a another element to achieve a stable octetstable octet Gain or Lose Valence Gain or Lose Valence ElectronsElectronsComplete this sentence: Complete this sentence:
Noble Gases do not easily form bonds Noble Gases do not easily form bonds because….because….
Why do atoms form bonds?Why do atoms form bonds?To be more chemically stable and less reactiveTo be more chemically stable and less reactive
How do atoms become more How do atoms become more chemically stable and less reactive?chemically stable and less reactive? By having completely filled s and p By having completely filled s and p orbitals just like the noble gases orbitals just like the noble gases
Section 7.2 – Ionic BondsSection 7.2 – Ionic BondsIonic Compounds – metal cations Ionic Compounds – metal cations
and nonmetal anions that are held and nonmetal anions that are held together by electrostatic forcestogether by electrostatic forces
Although ionic compounds are Although ionic compounds are composed of ions, they are composed of ions, they are electrically neutralelectrically neutral
Ionic BondingIonic Bonding An ion is an atom that has gained or lost An ion is an atom that has gained or lost
one or more electrons and thus have an one or more electrons and thus have an electrical charge. electrical charge.
To find the charge of the ion subtract the To find the charge of the ion subtract the number of electrons from the number of number of electrons from the number of protons.protons.
Example: [S]=1sExample: [S]=1s222s2s222p2p663s3s223p3p44 (16 p+, 16e-) (16 p+, 16e-)
[S[S2-2-] 1s] 1s222s2s222p2p663s3s223p3p6 6 (16p+, 18e-)(16p+, 18e-)16 -18 = -216 -18 = -2
Labeling the Periodic TableLabeling the Periodic TableThese elements have the following charges:These elements have the following charges:Group 1A = 1+Group 1A = 1+Group 2A = 2+ Group 2A = 2+ Group 3A = 3+Group 3A = 3+Group 4A = 4+ or 4-Group 4A = 4+ or 4-Group 5A = 3-Group 5A = 3-Group 6A = 2-Group 6A = 2-Group 7A = 1-Group 7A = 1-
When cations and anions form bonds When cations and anions form bonds with each other they are called with each other they are called SALTSSALTS
The + and - charges that cations and anions The + and - charges that cations and anions have causes an attraction between the two have causes an attraction between the two
They come together to form an ionic bond also They come together to form an ionic bond also known as a salt.known as a salt.
Example:Example: NaNa++ ClCl--
NaCl NaCl
SALTS
When cations and anions form bonds When cations and anions form bonds with each other they are called SALTSwith each other they are called SALTS
Example:Example:
Li Li 1s1s 2p2p
FF1s1s 2p2p
Li+
F-LiF
SALTS
Practice Practice Show how the following compounds bond Show how the following compounds bond
with the use of orbital diagramswith the use of orbital diagrams1.1. NaFNaF2.2. KBrKBr3.3. MgOMgO4.4. LiLi22SS
5.5. CaClCaCl226.6. AlNAlN
Ionic BondsIonic Bonds Ionic bond is typically a bond Ionic bond is typically a bond
between a METAL CATION and a between a METAL CATION and a NONMETAL ANIONNONMETAL ANIONThe electrostatic forces between the two The electrostatic forces between the two
types of ions hold them togethertypes of ions hold them together
• Bonds form when metals donate Bonds form when metals donate electrons to nonmetalselectrons to nonmetals
Properties of Ionic CompoundsProperties of Ionic CompoundsCrystallineCrystalline Solid at Room TemperatureSolid at Room TemperatureHigh Melting PointsHigh Melting PointsCan conduct an electric current when Can conduct an electric current when
melted or dissolved in watermelted or dissolved in water
Section 7.3 – Bonding in MetalsSection 7.3 – Bonding in Metals
Metallic bond is a bond between Metallic bond is a bond between metal cations.metal cations.
The attraction of the free floating The attraction of the free floating valence electrons for the positively valence electrons for the positively charged metal ions hold them charged metal ions hold them together. together.
Crystalline Structure of MetalsCrystalline Structure of MetalsMetal atoms are arranged in very compact Metal atoms are arranged in very compact
and orderly patternsand orderly patternsPhysical Properties of MetalsPhysical Properties of Metals
Good Conductors of electrical currentGood Conductors of electrical currentDuctile - can be drawn into wiresDuctile - can be drawn into wiresMalleable – can be hammered or shapedMalleable – can be hammered or shaped
Alloys – mixtures composed of two or Alloys – mixtures composed of two or more elements, at least one being a metalmore elements, at least one being a metal
HomeworkHomework
Chapter 7 AssessmentChapter 7 Assessment#’s 30-44, 48, 53, 55, 56, 58, 59, 60, 62, 63, #’s 30-44, 48, 53, 55, 56, 58, 59, 60, 62, 63,
64, 65, 72, 73, 87, 88, 90, 92, 93, 94, 9564, 65, 72, 73, 87, 88, 90, 92, 93, 94, 95